About 1-(piperidin-4-ylmethyl)-3-(1,3,4-thiadiazol-2-yl)urea
1-(piperidin-4-ylmethyl)-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 50949943) has the molecular formula C9H15N5OS
and a molecular weight of 241.32 g/mol. Its IUPAC name is 1-(piperidin-4-ylmethyl)-3-(1,3,4-thiadiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-(piperidin-4-ylmethyl)-3-(1,3,4-thiadiazol-2-yl)urea |
| PubChem CID | 50949943 |
| Molecular Formula | C9H15N5OS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 1-(piperidin-4-ylmethyl)-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | O=C(NCC1CCNCC1)Nc1nncs1 |
| InChI | InChI=1S/C9H15N5OS/c15-8(13-9-14-12-6-16-9)11-5-7-1-3-10-4-2-7/h6-7,10H,1-5H2,(H2,11,13,14,15) |
| InChIKey | KFVOWJHMFSXGEA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(piperidin-4-ylmethyl)-3-(1,3,4-thiadiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(piperidin-4-ylmethyl)-3-(1,3,4-thiadiazol-2-yl)urea?
The IUPAC name of 1-(piperidin-4-ylmethyl)-3-(1,3,4-thiadiazol-2-yl)urea (CID 50949943) is 1-(piperidin-4-ylmethyl)-3-(1,3,4-thiadiazol-2-yl)urea.
What is the SMILES notation for 1-(piperidin-4-ylmethyl)-3-(1,3,4-thiadiazol-2-yl)urea?
The canonical SMILES for 1-(piperidin-4-ylmethyl)-3-(1,3,4-thiadiazol-2-yl)urea is O=C(NCC1CCNCC1)Nc1nncs1.
What is the InChIKey of 1-(piperidin-4-ylmethyl)-3-(1,3,4-thiadiazol-2-yl)urea?
The InChIKey is KFVOWJHMFSXGEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5OS/c15-8(13-9-14-12-6-16-9)11-5-7-1-3-10-4-2-7/h6-7,10H,1-5H2,(H2,11,13,14,15).
What are the key properties of 1-(piperidin-4-ylmethyl)-3-(1,3,4-thiadiazol-2-yl)urea?
1-(piperidin-4-ylmethyl)-3-(1,3,4-thiadiazol-2-yl)urea has a molecular weight of 241.32 g/mol, XLogP of 0.66, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(piperidin-4-ylmethyl)-3-(1,3,4-thiadiazol-2-yl)urea is sourced from PubChem (CID 50949943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).