C17H24ClFN2O — CID 50950054
[(1S,3R,3aR,6aS)-1-(3-chloro-4-fluorophenyl)-3,5-diethyl-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-yl]methanol (PubChem CID 50950054) has the molecular formula C17H24ClFN2O and a molecular weight of 326.84 g/mol. Its IUPAC name is [(1S,3R,3aR,6aS)-1-(3-chloro-4-fluorophenyl)-3,5-diethyl-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-yl]methanol.
| Compound Name | [(1S,3R,3aR,6aS)-1-(3-chloro-4-fluorophenyl)-3,5-diethyl-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 50950054 |
| Molecular Formula | C17H24ClFN2O |
| Molecular Weight | 326.84 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | [(1S,3R,3aR,6aS)-1-(3-chloro-4-fluorophenyl)-3,5-diethyl-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-yl]methanol |
| SMILES | CCN1C[C@H]2[C@@H](c3ccc(F)c(Cl)c3)N[C@@](CC)(CO)[C@H]2C1 |
| InChI | InChI=1S/C17H24ClFN2O/c1-3-17(10-22)13-9-21(4-2)8-12(13)16(20-17)11-5-6-15(19)14(18)7-11/h5-7,12-13,16,20,22H,3-4,8-10H2,1-2H3/t12-,13+,16-,17+/m1/s1 |
| InChIKey | BQXDMIICMMCIAT-GFOFROLCSA-N |
| XLogP | 2.83 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.84 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |