C12H23N3O3S — CID 50950210
(3aR,6aR)-N-(2-ethylsulfonylethyl)-5-methyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 50950210) has the molecular formula C12H23N3O3S and a molecular weight of 289.40 g/mol. Its IUPAC name is (3aR,6aR)-N-(2-ethylsulfonylethyl)-5-methyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aR,6aR)-N-(2-ethylsulfonylethyl)-5-methyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 50950210 |
| Molecular Formula | C12H23N3O3S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (3aR,6aR)-N-(2-ethylsulfonylethyl)-5-methyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | CCS(=O)(=O)CCNC(=O)[C@@]12CNC[C@@H]1CN(C)C2 |
| InChI | InChI=1S/C12H23N3O3S/c1-3-19(17,18)5-4-14-11(16)12-8-13-6-10(12)7-15(2)9-12/h10,13H,3-9H2,1-2H3,(H,14,16)/t10-,12-/m1/s1 |
| InChIKey | OKILATDIWZBMNJ-ZYHUDNBSSA-N |
| XLogP | -1.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |