C12H19FN4O — CID 50950437
N-butyl-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 50950437) has the molecular formula C12H19FN4O and a molecular weight of 254.31 g/mol. Its IUPAC name is N-butyl-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | N-butyl-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 50950437 |
| Molecular Formula | C12H19FN4O |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-butyl-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | CCCCNc1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C12H19FN4O/c1-2-3-4-14-12-15-9-10(13)11(16-12)17-5-7-18-8-6-17/h9H,2-8H2,1H3,(H,14,15,16) |
| InChIKey | YFBFDRWHMWAYRL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|