About 3-[4-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carbonitrile
3-[4-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carbonitrile (PubChem CID 50950605) has the molecular formula C21H23N7
and a molecular weight of 373.46 g/mol. Its IUPAC name is 3-[4-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-[4-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carbonitrile |
| PubChem CID | 50950605 |
| Molecular Formula | C21H23N7 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 3-[4-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carbonitrile |
| SMILES | Cc1cc(C)n(-c2cccc(CN3CCN(c4nccnc4C#N)CC3)c2)n1 |
| InChI | InChI=1S/C21H23N7/c1-16-12-17(2)28(25-16)19-5-3-4-18(13-19)15-26-8-10-27(11-9-26)21-20(14-22)23-6-7-24-21/h3-7,12-13H,8-11,15H2,1-2H3 |
| InChIKey | UQQOPQPSUIBHML-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 73.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[4-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carbonitrile?
The IUPAC name of 3-[4-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carbonitrile (CID 50950605) is 3-[4-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carbonitrile.
What is the SMILES notation for 3-[4-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carbonitrile?
The canonical SMILES for 3-[4-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carbonitrile is Cc1cc(C)n(-c2cccc(CN3CCN(c4nccnc4C#N)CC3)c2)n1.
What is the InChIKey of 3-[4-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carbonitrile?
The InChIKey is UQQOPQPSUIBHML-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N7/c1-16-12-17(2)28(25-16)19-5-3-4-18(13-19)15-26-8-10-27(11-9-26)21-20(14-22)23-6-7-24-21/h3-7,12-13H,8-11,15H2,1-2H3.
What are the key properties of 3-[4-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carbonitrile?
3-[4-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carbonitrile has a molecular weight of 373.46 g/mol, XLogP of 2.47, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carbonitrile is sourced from PubChem (CID 50950605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).