C13H18F2N2O2 — CID 50950819
2-[[2-(difluoromethoxy)phenyl]methyl-methylamino]-N-methylpropanamide (PubChem CID 50950819) has the molecular formula C13H18F2N2O2 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-[[2-(difluoromethoxy)phenyl]methyl-methylamino]-N-methylpropanamide.
| Compound Name | 2-[[2-(difluoromethoxy)phenyl]methyl-methylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 50950819 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-[[2-(difluoromethoxy)phenyl]methyl-methylamino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)N(C)Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C13H18F2N2O2/c1-9(12(18)16-2)17(3)8-10-6-4-5-7-11(10)19-13(14)15/h4-7,9,13H,8H2,1-3H3,(H,16,18) |
| InChIKey | XROUVCMMCZMAPY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |