C21H24FNO2 — CID 50951113
N-[(2S,4R,6S)-2-benzyl-6-(3-fluoro-5-methylphenyl)oxan-4-yl]acetamide (PubChem CID 50951113) has the molecular formula C21H24FNO2 and a molecular weight of 341.43 g/mol. Its IUPAC name is N-[(2S,4R,6S)-2-benzyl-6-(3-fluoro-5-methylphenyl)oxan-4-yl]acetamide.
| Compound Name | N-[(2S,4R,6S)-2-benzyl-6-(3-fluoro-5-methylphenyl)oxan-4-yl]acetamide |
|---|---|
| PubChem CID | 50951113 |
| Molecular Formula | C21H24FNO2 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-[(2S,4R,6S)-2-benzyl-6-(3-fluoro-5-methylphenyl)oxan-4-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C[C@H](Cc2ccccc2)O[C@H](c2cc(C)cc(F)c2)C1 |
| InChI | InChI=1S/C21H24FNO2/c1-14-8-17(11-18(22)9-14)21-13-19(23-15(2)24)12-20(25-21)10-16-6-4-3-5-7-16/h3-9,11,19-21H,10,12-13H2,1-2H3,(H,23,24)/t19-,20+,21+/m1/s1 |
| InChIKey | RRDYJMAHQBOSQV-HKBOAZHASA-N |
| XLogP | 4.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |