About 2-[2-[(6,8-dimethoxy-4-methylquinolin-2-yl)amino]ethoxy]ethanol
2-[2-[(6,8-dimethoxy-4-methylquinolin-2-yl)amino]ethoxy]ethanol (PubChem CID 50951120) has the molecular formula C16H22N2O4
and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-[2-[(6,8-dimethoxy-4-methylquinolin-2-yl)amino]ethoxy]ethanol.
Molecular Properties
| Compound Name | 2-[2-[(6,8-dimethoxy-4-methylquinolin-2-yl)amino]ethoxy]ethanol |
| PubChem CID | 50951120 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-[2-[(6,8-dimethoxy-4-methylquinolin-2-yl)amino]ethoxy]ethanol |
| SMILES | COc1cc(OC)c2nc(NCCOCCO)cc(C)c2c1 |
| InChI | InChI=1S/C16H22N2O4/c1-11-8-15(17-4-6-22-7-5-19)18-16-13(11)9-12(20-2)10-14(16)21-3/h8-10,19H,4-7H2,1-3H3,(H,17,18) |
| InChIKey | HILDPJXAAUCKRF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(6,8-dimethoxy-4-methylquinolin-2-yl)amino]ethoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(6,8-dimethoxy-4-methylquinolin-2-yl)amino]ethoxy]ethanol?
The IUPAC name of 2-[2-[(6,8-dimethoxy-4-methylquinolin-2-yl)amino]ethoxy]ethanol (CID 50951120) is 2-[2-[(6,8-dimethoxy-4-methylquinolin-2-yl)amino]ethoxy]ethanol.
What is the SMILES notation for 2-[2-[(6,8-dimethoxy-4-methylquinolin-2-yl)amino]ethoxy]ethanol?
The canonical SMILES for 2-[2-[(6,8-dimethoxy-4-methylquinolin-2-yl)amino]ethoxy]ethanol is COc1cc(OC)c2nc(NCCOCCO)cc(C)c2c1.
What is the InChIKey of 2-[2-[(6,8-dimethoxy-4-methylquinolin-2-yl)amino]ethoxy]ethanol?
The InChIKey is HILDPJXAAUCKRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O4/c1-11-8-15(17-4-6-22-7-5-19)18-16-13(11)9-12(20-2)10-14(16)21-3/h8-10,19H,4-7H2,1-3H3,(H,17,18).
What are the key properties of 2-[2-[(6,8-dimethoxy-4-methylquinolin-2-yl)amino]ethoxy]ethanol?
2-[2-[(6,8-dimethoxy-4-methylquinolin-2-yl)amino]ethoxy]ethanol has a molecular weight of 306.36 g/mol, XLogP of 1.98, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(6,8-dimethoxy-4-methylquinolin-2-yl)amino]ethoxy]ethanol is sourced from PubChem (CID 50951120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).