C15H19N3O5 — CID 50951290
methyl (1S,3R,3aS,6aR)-1-(3,5-dimethyl-1,2-oxazol-4-yl)-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 50951290) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is methyl (1S,3R,3aS,6aR)-1-(3,5-dimethyl-1,2-oxazol-4-yl)-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1S,3R,3aS,6aR)-1-(3,5-dimethyl-1,2-oxazol-4-yl)-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 50951290 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | methyl (1S,3R,3aS,6aR)-1-(3,5-dimethyl-1,2-oxazol-4-yl)-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@]1(C)N[C@H](c2c(C)noc2C)[C@@H]2C(=O)N(C)C(=O)[C@@H]21 |
| InChI | InChI=1S/C15H19N3O5/c1-6-8(7(2)23-17-6)11-9-10(13(20)18(4)12(9)19)15(3,16-11)14(21)22-5/h9-11,16H,1-5H3/t9-,10-,11-,15-/m1/s1 |
| InChIKey | HTOCAWSWUAYNEY-UYUMYWFVSA-N |
| XLogP | 0.10 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|