C24H32N2O — CID 50951413
[(1S,3R,3aR,6aS)-5-methyl-3-(2-methylpropyl)-1-(2-phenylphenyl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-yl]methanol (PubChem CID 50951413) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is [(1S,3R,3aR,6aS)-5-methyl-3-(2-methylpropyl)-1-(2-phenylphenyl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-yl]methanol.
| Compound Name | [(1S,3R,3aR,6aS)-5-methyl-3-(2-methylpropyl)-1-(2-phenylphenyl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 50951413 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | [(1S,3R,3aR,6aS)-5-methyl-3-(2-methylpropyl)-1-(2-phenylphenyl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-yl]methanol |
| SMILES | CC(C)C[C@@]1(CO)N[C@H](c2ccccc2-c2ccccc2)[C@@H]2CN(C)C[C@@H]21 |
| InChI | InChI=1S/C24H32N2O/c1-17(2)13-24(16-27)22-15-26(3)14-21(22)23(25-24)20-12-8-7-11-19(20)18-9-5-4-6-10-18/h4-12,17,21-23,25,27H,13-16H2,1-3H3/t21-,22+,23-,24+/m1/s1 |
| InChIKey | XQWAPSKEGMLKCG-QPXUXIHVSA-N |
| XLogP | 3.95 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |