About 2-[1-(2-methylpyrazol-3-yl)propylamino]propane-1,3-diol
2-[1-(2-methylpyrazol-3-yl)propylamino]propane-1,3-diol (PubChem CID 50951907) has the molecular formula C10H19N3O2
and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-[1-(2-methylpyrazol-3-yl)propylamino]propane-1,3-diol.
Molecular Properties
| Compound Name | 2-[1-(2-methylpyrazol-3-yl)propylamino]propane-1,3-diol |
| PubChem CID | 50951907 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-[1-(2-methylpyrazol-3-yl)propylamino]propane-1,3-diol |
| SMILES | CCC(NC(CO)CO)c1ccnn1C |
| InChI | InChI=1S/C10H19N3O2/c1-3-9(12-8(6-14)7-15)10-4-5-11-13(10)2/h4-5,8-9,12,14-15H,3,6-7H2,1-2H3 |
| InChIKey | PPRDDYJPFWBNLP-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-(2-methylpyrazol-3-yl)propylamino]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2-methylpyrazol-3-yl)propylamino]propane-1,3-diol?
The IUPAC name of 2-[1-(2-methylpyrazol-3-yl)propylamino]propane-1,3-diol (CID 50951907) is 2-[1-(2-methylpyrazol-3-yl)propylamino]propane-1,3-diol.
What is the SMILES notation for 2-[1-(2-methylpyrazol-3-yl)propylamino]propane-1,3-diol?
The canonical SMILES for 2-[1-(2-methylpyrazol-3-yl)propylamino]propane-1,3-diol is CCC(NC(CO)CO)c1ccnn1C.
What is the InChIKey of 2-[1-(2-methylpyrazol-3-yl)propylamino]propane-1,3-diol?
The InChIKey is PPRDDYJPFWBNLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O2/c1-3-9(12-8(6-14)7-15)10-4-5-11-13(10)2/h4-5,8-9,12,14-15H,3,6-7H2,1-2H3.
What are the key properties of 2-[1-(2-methylpyrazol-3-yl)propylamino]propane-1,3-diol?
2-[1-(2-methylpyrazol-3-yl)propylamino]propane-1,3-diol has a molecular weight of 213.28 g/mol, XLogP of -0.19, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-methylpyrazol-3-yl)propylamino]propane-1,3-diol is sourced from PubChem (CID 50951907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).