C16H24FN3O2 — CID 50952079
N-butyl-2-(dimethylcarbamoylamino)-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 50952079) has the molecular formula C16H24FN3O2 and a molecular weight of 309.39 g/mol. Its IUPAC name is N-butyl-2-(dimethylcarbamoylamino)-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | N-butyl-2-(dimethylcarbamoylamino)-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 50952079 |
| Molecular Formula | C16H24FN3O2 |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | N-butyl-2-(dimethylcarbamoylamino)-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | CCCCN(Cc1ccc(F)cc1)C(=O)CNC(=O)N(C)C |
| InChI | InChI=1S/C16H24FN3O2/c1-4-5-10-20(12-13-6-8-14(17)9-7-13)15(21)11-18-16(22)19(2)3/h6-9H,4-5,10-12H2,1-3H3,(H,18,22) |
| InChIKey | ZVURDBZHPMCNKY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |