C15H19N3O3S — CID 50952228
(8R,9aS)-8-hydroxy-2-(2-pyridin-2-ylsulfanylethyl)-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione (PubChem CID 50952228) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is (8R,9aS)-8-hydroxy-2-(2-pyridin-2-ylsulfanylethyl)-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione.
| Compound Name | (8R,9aS)-8-hydroxy-2-(2-pyridin-2-ylsulfanylethyl)-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 50952228 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | (8R,9aS)-8-hydroxy-2-(2-pyridin-2-ylsulfanylethyl)-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
| SMILES | O=C1[C@@H]2C[C@H](O)CCN2C(=O)CN1CCSc1ccccn1 |
| InChI | InChI=1S/C15H19N3O3S/c19-11-4-6-18-12(9-11)15(21)17(10-14(18)20)7-8-22-13-3-1-2-5-16-13/h1-3,5,11-12,19H,4,6-10H2/t11-,12+/m1/s1 |
| InChIKey | FZODARSIINHXHR-NEPJUHHUSA-N |
| XLogP | 0.37 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |