C18H26N4O — CID 50952518
N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-1-phenoxypropan-2-amine (PubChem CID 50952518) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-1-phenoxypropan-2-amine.
| Compound Name | N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-1-phenoxypropan-2-amine |
|---|---|
| PubChem CID | 50952518 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-1-phenoxypropan-2-amine |
| SMILES | CC(COc1ccccc1)NCc1nncn1C1CCCCC1 |
| InChI | InChI=1S/C18H26N4O/c1-15(13-23-17-10-6-3-7-11-17)19-12-18-21-20-14-22(18)16-8-4-2-5-9-16/h3,6-7,10-11,14-16,19H,2,4-5,8-9,12-13H2,1H3 |
| InChIKey | UPEAJVQRGLDNPG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |