C22H27FN2O — CID 50952836
[(1S,3R,3aR,6aS)-3-ethyl-1-(3-fluoro-4-methylphenyl)-5-phenyl-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-yl]methanol (PubChem CID 50952836) has the molecular formula C22H27FN2O and a molecular weight of 354.47 g/mol. Its IUPAC name is [(1S,3R,3aR,6aS)-3-ethyl-1-(3-fluoro-4-methylphenyl)-5-phenyl-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-yl]methanol.
| Compound Name | [(1S,3R,3aR,6aS)-3-ethyl-1-(3-fluoro-4-methylphenyl)-5-phenyl-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 50952836 |
| Molecular Formula | C22H27FN2O |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | [(1S,3R,3aR,6aS)-3-ethyl-1-(3-fluoro-4-methylphenyl)-5-phenyl-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-yl]methanol |
| SMILES | CC[C@@]1(CO)N[C@H](c2ccc(C)c(F)c2)[C@@H]2CN(c3ccccc3)C[C@@H]21 |
| InChI | InChI=1S/C22H27FN2O/c1-3-22(14-26)19-13-25(17-7-5-4-6-8-17)12-18(19)21(24-22)16-10-9-15(2)20(23)11-16/h4-11,18-19,21,24,26H,3,12-14H2,1-2H3/t18-,19+,21-,22+/m1/s1 |
| InChIKey | VHRDAKQAEFSAIP-KIZRIRGWSA-N |
| XLogP | 3.67 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |