C18H30N4O3 — CID 50953651
(3aR,6aR)-5-(cyclopropanecarbonyl)-N-(3-morpholin-4-ylpropyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 50953651) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is (3aR,6aR)-5-(cyclopropanecarbonyl)-N-(3-morpholin-4-ylpropyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aR,6aR)-5-(cyclopropanecarbonyl)-N-(3-morpholin-4-ylpropyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 50953651 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (3aR,6aR)-5-(cyclopropanecarbonyl)-N-(3-morpholin-4-ylpropyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | O=C(C1CC1)N1C[C@H]2CNC[C@@]2(C(=O)NCCCN2CCOCC2)C1 |
| InChI | InChI=1S/C18H30N4O3/c23-16(14-2-3-14)22-11-15-10-19-12-18(15,13-22)17(24)20-4-1-5-21-6-8-25-9-7-21/h14-15,19H,1-13H2,(H,20,24)/t15-,18-/m1/s1 |
| InChIKey | AGTYCJRXCBRCEW-CRAIPNDOSA-N |
| XLogP | -0.72 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|