C16H23FN4O3 — CID 50953683
ethyl 1-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)piperidine-4-carboxylate (PubChem CID 50953683) has the molecular formula C16H23FN4O3 and a molecular weight of 338.38 g/mol. Its IUPAC name is ethyl 1-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 50953683 |
| Molecular Formula | C16H23FN4O3 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | ethyl 1-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncc(F)c(N3CCOCC3)n2)CC1 |
| InChI | InChI=1S/C16H23FN4O3/c1-2-24-15(22)12-3-5-21(6-4-12)16-18-11-13(17)14(19-16)20-7-9-23-10-8-20/h11-12H,2-10H2,1H3 |
| InChIKey | DWGHQWWXEWONGY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |