C16H28N4S — CID 50954231
1-[(E)-hex-2-enyl]-4-[(4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methyl]piperidine (PubChem CID 50954231) has the molecular formula C16H28N4S and a molecular weight of 308.50 g/mol. Its IUPAC name is 1-[(E)-hex-2-enyl]-4-[(4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methyl]piperidine.
| Compound Name | 1-[(E)-hex-2-enyl]-4-[(4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methyl]piperidine |
|---|---|
| PubChem CID | 50954231 |
| Molecular Formula | C16H28N4S |
| Molecular Weight | 308.50 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 1-[(E)-hex-2-enyl]-4-[(4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methyl]piperidine |
| SMILES | CCC/C=C/CN1CCC(Cc2nnc(SC)n2C)CC1 |
| InChI | InChI=1S/C16H28N4S/c1-4-5-6-7-10-20-11-8-14(9-12-20)13-15-17-18-16(21-3)19(15)2/h6-7,14H,4-5,8-13H2,1-3H3/b7-6+ |
| InChIKey | WDVNQYBGUGZLAE-VOTSOKGWSA-N |
| XLogP | 3.15 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|