C17H24N4 — CID 50954302
1-[2-[3-(2-phenylethyl)-1H-1,2,4-triazol-5-yl]ethyl]piperidine (PubChem CID 50954302) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 1-[2-[3-(2-phenylethyl)-1H-1,2,4-triazol-5-yl]ethyl]piperidine.
| Compound Name | 1-[2-[3-(2-phenylethyl)-1H-1,2,4-triazol-5-yl]ethyl]piperidine |
|---|---|
| PubChem CID | 50954302 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 1-[2-[3-(2-phenylethyl)-1H-1,2,4-triazol-5-yl]ethyl]piperidine |
| SMILES | c1ccc(CCc2n[nH]c(CCN3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C17H24N4/c1-3-7-15(8-4-1)9-10-16-18-17(20-19-16)11-14-21-12-5-2-6-13-21/h1,3-4,7-8H,2,5-6,9-14H2,(H,18,19,20) |
| InChIKey | DBIZXHVHZMRQMQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |