C16H24N6O — CID 50954403
N,1-dimethyl-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 50954403) has the molecular formula C16H24N6O and a molecular weight of 316.41 g/mol. Its IUPAC name is N,1-dimethyl-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | N,1-dimethyl-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 50954403 |
| Molecular Formula | C16H24N6O |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | N,1-dimethyl-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CCCn1cnnc1CN(C)C(=O)c1nn(C)c2c1CCCC2 |
| InChI | InChI=1S/C16H24N6O/c1-4-9-22-11-17-18-14(22)10-20(2)16(23)15-12-7-5-6-8-13(12)21(3)19-15/h11H,4-10H2,1-3H3 |
| InChIKey | HYKRVFFGSBRMNJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |