C20H21N3O2 — CID 50954483
5-methyl-N-[2-(3-phenylpropoxy)phenyl]-1H-pyrazole-4-carboxamide (PubChem CID 50954483) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 5-methyl-N-[2-(3-phenylpropoxy)phenyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-methyl-N-[2-(3-phenylpropoxy)phenyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 50954483 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 5-methyl-N-[2-(3-phenylpropoxy)phenyl]-1H-pyrazole-4-carboxamide |
| SMILES | Cc1[nH]ncc1C(=O)Nc1ccccc1OCCCc1ccccc1 |
| InChI | InChI=1S/C20H21N3O2/c1-15-17(14-21-23-15)20(24)22-18-11-5-6-12-19(18)25-13-7-10-16-8-3-2-4-9-16/h2-6,8-9,11-12,14H,7,10,13H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | XWMYMCRNQNDQCP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|