C21H21NO5 — CID 50954568
8-[3-methoxy-2-(2-methylprop-2-enoxy)phenyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-6-one (PubChem CID 50954568) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 8-[3-methoxy-2-(2-methylprop-2-enoxy)phenyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-6-one.
| Compound Name | 8-[3-methoxy-2-(2-methylprop-2-enoxy)phenyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-6-one |
|---|---|
| PubChem CID | 50954568 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 8-[3-methoxy-2-(2-methylprop-2-enoxy)phenyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-6-one |
| SMILES | C=C(C)COc1c(OC)cccc1C1CC(=O)Nc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C21H21NO5/c1-12(2)10-25-21-13(5-4-6-17(21)24-3)14-8-20(23)22-16-9-19-18(7-15(14)16)26-11-27-19/h4-7,9,14H,1,8,10-11H2,2-3H3,(H,22,23) |
| InChIKey | OWMGEWWOGVPFLM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|