C19H23N5S — CID 50954576
1-[2-(2-methylimidazol-1-yl)phenyl]-N-[(2-propylsulfanylpyrimidin-5-yl)methyl]methanamine (PubChem CID 50954576) has the molecular formula C19H23N5S and a molecular weight of 353.50 g/mol. Its IUPAC name is 1-[2-(2-methylimidazol-1-yl)phenyl]-N-[(2-propylsulfanylpyrimidin-5-yl)methyl]methanamine.
| Compound Name | 1-[2-(2-methylimidazol-1-yl)phenyl]-N-[(2-propylsulfanylpyrimidin-5-yl)methyl]methanamine |
|---|---|
| PubChem CID | 50954576 |
| Molecular Formula | C19H23N5S |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-[2-(2-methylimidazol-1-yl)phenyl]-N-[(2-propylsulfanylpyrimidin-5-yl)methyl]methanamine |
| SMILES | CCCSc1ncc(CNCc2ccccc2-n2ccnc2C)cn1 |
| InChI | InChI=1S/C19H23N5S/c1-3-10-25-19-22-12-16(13-23-19)11-20-14-17-6-4-5-7-18(17)24-9-8-21-15(24)2/h4-9,12-13,20H,3,10-11,14H2,1-2H3 |
| InChIKey | PMQDVVUDOKPQCE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |