C15H24N4O3 — CID 50954739
2-[2-[cyclopentyl(methyl)amino]acetyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 50954739) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-[2-[cyclopentyl(methyl)amino]acetyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | 2-[2-[cyclopentyl(methyl)amino]acetyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 50954739 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 2-[2-[cyclopentyl(methyl)amino]acetyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CN(CC(=O)N1CCN2C(=O)CNC(=O)C2C1)C1CCCC1 |
| InChI | InChI=1S/C15H24N4O3/c1-17(11-4-2-3-5-11)10-14(21)18-6-7-19-12(9-18)15(22)16-8-13(19)20/h11-12H,2-10H2,1H3,(H,16,22) |
| InChIKey | QNOHIIYZWPLEJS-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |