C15H22N4O2S — CID 50954941
2-(2-methyl-2,8-diazaspiro[4.5]decan-8-yl)-N-(4-methyl-1,3-thiazol-2-yl)-2-oxoacetamide (PubChem CID 50954941) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is 2-(2-methyl-2,8-diazaspiro[4.5]decan-8-yl)-N-(4-methyl-1,3-thiazol-2-yl)-2-oxoacetamide.
| Compound Name | 2-(2-methyl-2,8-diazaspiro[4.5]decan-8-yl)-N-(4-methyl-1,3-thiazol-2-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 50954941 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2-(2-methyl-2,8-diazaspiro[4.5]decan-8-yl)-N-(4-methyl-1,3-thiazol-2-yl)-2-oxoacetamide |
| SMILES | Cc1csc(NC(=O)C(=O)N2CCC3(CCN(C)C3)CC2)n1 |
| InChI | InChI=1S/C15H22N4O2S/c1-11-9-22-14(16-11)17-12(20)13(21)19-7-4-15(5-8-19)3-6-18(2)10-15/h9H,3-8,10H2,1-2H3,(H,16,17,20) |
| InChIKey | VVCOAAHSFVFNKD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|