About N-cyclohexyl-3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide
N-cyclohexyl-3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 5095516) has the molecular formula C23H25N3O4S
and a molecular weight of 439.54 g/mol. Its IUPAC name is N-cyclohexyl-3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| PubChem CID | 5095516 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-cyclohexyl-3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | COc1ccc(-n2c(=S)[nH]c3cc(C(=O)NC4CCCCC4)ccc3c2=O)c(OC)c1 |
| InChI | InChI=1S/C23H25N3O4S/c1-29-16-9-11-19(20(13-16)30-2)26-22(28)17-10-8-14(12-18(17)25-23(26)31)21(27)24-15-6-4-3-5-7-15/h8-13,15H,3-7H2,1-2H3,(H,24,27)(H,25,31) |
| InChIKey | XRVBLCKEFXLQRO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide?
The IUPAC name of N-cyclohexyl-3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (CID 5095516) is N-cyclohexyl-3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
What is the SMILES notation for N-cyclohexyl-3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide?
The canonical SMILES for N-cyclohexyl-3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide is COc1ccc(-n2c(=S)[nH]c3cc(C(=O)NC4CCCCC4)ccc3c2=O)c(OC)c1.
What is the InChIKey of N-cyclohexyl-3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide?
The InChIKey is XRVBLCKEFXLQRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O4S/c1-29-16-9-11-19(20(13-16)30-2)26-22(28)17-10-8-14(12-18(17)25-23(26)31)21(27)24-15-6-4-3-5-7-15/h8-13,15H,3-7H2,1-2H3,(H,24,27)(H,25,31).
What are the key properties of N-cyclohexyl-3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide?
N-cyclohexyl-3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide has a molecular weight of 439.54 g/mol, XLogP of 4.13, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide is sourced from PubChem (CID 5095516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).