C13H16ClNO4 — CID 50955470
(2R,4S)-1-[(5-chloro-2-hydroxyphenyl)methyl]-4-hydroxypiperidine-2-carboxylic acid (PubChem CID 50955470) has the molecular formula C13H16ClNO4 and a molecular weight of 285.73 g/mol. Its IUPAC name is (2R,4S)-1-[(5-chloro-2-hydroxyphenyl)methyl]-4-hydroxypiperidine-2-carboxylic acid.
| Compound Name | (2R,4S)-1-[(5-chloro-2-hydroxyphenyl)methyl]-4-hydroxypiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 50955470 |
| Molecular Formula | C13H16ClNO4 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | (2R,4S)-1-[(5-chloro-2-hydroxyphenyl)methyl]-4-hydroxypiperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@@H](O)CCN1Cc1cc(Cl)ccc1O |
| InChI | InChI=1S/C13H16ClNO4/c14-9-1-2-12(17)8(5-9)7-15-4-3-10(16)6-11(15)13(18)19/h1-2,5,10-11,16-17H,3-4,6-7H2,(H,18,19)/t10-,11+/m0/s1 |
| InChIKey | GFQDQIKEOSJQOQ-WDEREUQCSA-N |
| XLogP | 1.46 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|