About N'-[2-(azepan-1-yl)ethyl]-N-(2-ethoxyphenyl)-N'-ethylpropanediamide
N'-[2-(azepan-1-yl)ethyl]-N-(2-ethoxyphenyl)-N'-ethylpropanediamide (PubChem CID 50955516) has the molecular formula C21H33N3O3
and a molecular weight of 375.51 g/mol. Its IUPAC name is N'-[2-(azepan-1-yl)ethyl]-N-(2-ethoxyphenyl)-N'-ethylpropanediamide.
Molecular Properties
| Compound Name | N'-[2-(azepan-1-yl)ethyl]-N-(2-ethoxyphenyl)-N'-ethylpropanediamide |
| PubChem CID | 50955516 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | N'-[2-(azepan-1-yl)ethyl]-N-(2-ethoxyphenyl)-N'-ethylpropanediamide |
| SMILES | CCOc1ccccc1NC(=O)CC(=O)N(CC)CCN1CCCCCC1 |
| InChI | InChI=1S/C21H33N3O3/c1-3-24(16-15-23-13-9-5-6-10-14-23)21(26)17-20(25)22-18-11-7-8-12-19(18)27-4-2/h7-8,11-12H,3-6,9-10,13-17H2,1-2H3,(H,22,25) |
| InChIKey | WTXVESVUAQHNLM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(azepan-1-yl)ethyl]-N-(2-ethoxyphenyl)-N'-ethylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(azepan-1-yl)ethyl]-N-(2-ethoxyphenyl)-N'-ethylpropanediamide?
The IUPAC name of N'-[2-(azepan-1-yl)ethyl]-N-(2-ethoxyphenyl)-N'-ethylpropanediamide (CID 50955516) is N'-[2-(azepan-1-yl)ethyl]-N-(2-ethoxyphenyl)-N'-ethylpropanediamide.
What is the SMILES notation for N'-[2-(azepan-1-yl)ethyl]-N-(2-ethoxyphenyl)-N'-ethylpropanediamide?
The canonical SMILES for N'-[2-(azepan-1-yl)ethyl]-N-(2-ethoxyphenyl)-N'-ethylpropanediamide is CCOc1ccccc1NC(=O)CC(=O)N(CC)CCN1CCCCCC1.
What is the InChIKey of N'-[2-(azepan-1-yl)ethyl]-N-(2-ethoxyphenyl)-N'-ethylpropanediamide?
The InChIKey is WTXVESVUAQHNLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H33N3O3/c1-3-24(16-15-23-13-9-5-6-10-14-23)21(26)17-20(25)22-18-11-7-8-12-19(18)27-4-2/h7-8,11-12H,3-6,9-10,13-17H2,1-2H3,(H,22,25).
What are the key properties of N'-[2-(azepan-1-yl)ethyl]-N-(2-ethoxyphenyl)-N'-ethylpropanediamide?
N'-[2-(azepan-1-yl)ethyl]-N-(2-ethoxyphenyl)-N'-ethylpropanediamide has a molecular weight of 375.51 g/mol, XLogP of 3.14, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(azepan-1-yl)ethyl]-N-(2-ethoxyphenyl)-N'-ethylpropanediamide is sourced from PubChem (CID 50955516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).