C18H21N7S — CID 50955625
2,7-dimethyl-N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine (PubChem CID 50955625) has the molecular formula C18H21N7S and a molecular weight of 367.48 g/mol. Its IUPAC name is 2,7-dimethyl-N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine.
| Compound Name | 2,7-dimethyl-N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 50955625 |
| Molecular Formula | C18H21N7S |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2,7-dimethyl-N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
| SMILES | Cc1nc2c(c(NCc3csc(-c4cnccn4)n3)n1)CCN(C)CC2 |
| InChI | InChI=1S/C18H21N7S/c1-12-22-15-4-8-25(2)7-3-14(15)17(23-12)21-9-13-11-26-18(24-13)16-10-19-5-6-20-16/h5-6,10-11H,3-4,7-9H2,1-2H3,(H,21,22,23) |
| InChIKey | SZFYDMVTGISGMS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 79.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |