C16H18N6O2S2 — CID 5095564
3-(2-methoxyethylsulfanyl)-15,15-dimethyl-16-oxa-19-thia-2,4,5,7,8,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaene (PubChem CID 5095564) has the molecular formula C16H18N6O2S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 3-(2-methoxyethylsulfanyl)-15,15-dimethyl-16-oxa-19-thia-2,4,5,7,8,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaene.
| Compound Name | 3-(2-methoxyethylsulfanyl)-15,15-dimethyl-16-oxa-19-thia-2,4,5,7,8,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaene |
|---|---|
| PubChem CID | 5095564 |
| Molecular Formula | C16H18N6O2S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 3-(2-methoxyethylsulfanyl)-15,15-dimethyl-16-oxa-19-thia-2,4,5,7,8,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaene |
| SMILES | COCCSc1nnc2n3ncnc3c3c4c(sc3n12)COC(C)(C)C4 |
| InChI | InChI=1S/C16H18N6O2S2/c1-16(2)6-9-10(7-24-16)26-13-11(9)12-17-8-18-22(12)14-19-20-15(21(13)14)25-5-4-23-3/h8H,4-7H2,1-3H3 |
| InChIKey | AJGLGTRKMZZZEY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|