C21H24N4O — CID 50955650
[(2R,6S)-6-phenyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl)methanone (PubChem CID 50955650) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is [(2R,6S)-6-phenyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl)methanone.
| Compound Name | [(2R,6S)-6-phenyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 50955650 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | [(2R,6S)-6-phenyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl)methanone |
| SMILES | C=CC[C@@H]1CC=C[C@@H](c2ccccc2)N1C(=O)c1cc2n(n1)CCNC2 |
| InChI | InChI=1S/C21H24N4O/c1-2-7-17-10-6-11-20(16-8-4-3-5-9-16)25(17)21(26)19-14-18-15-22-12-13-24(18)23-19/h2-6,8-9,11,14,17,20,22H,1,7,10,12-13,15H2/t17-,20+/m1/s1 |
| InChIKey | OCFOXIYCEGXQCH-XLIONFOSSA-N |
| XLogP | 3.07 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|