C17H23N3O3 — CID 50955741
[2,6-dimethyl-4-[[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]methyl]phenyl] acetate (PubChem CID 50955741) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is [2,6-dimethyl-4-[[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]methyl]phenyl] acetate.
| Compound Name | [2,6-dimethyl-4-[[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 50955741 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | [2,6-dimethyl-4-[[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]methyl]phenyl] acetate |
| SMILES | CCC(NCc1cc(C)c(OC(C)=O)c(C)c1)c1nc(C)no1 |
| InChI | InChI=1S/C17H23N3O3/c1-6-15(17-19-12(4)20-23-17)18-9-14-7-10(2)16(11(3)8-14)22-13(5)21/h7-8,15,18H,6,9H2,1-5H3 |
| InChIKey | OWJRPASWMJKOPI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|