C17H28N4O — CID 50955778
N-[(1R,2S)-2-(methoxymethyl)cyclopentyl]-2,7-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine (PubChem CID 50955778) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is N-[(1R,2S)-2-(methoxymethyl)cyclopentyl]-2,7-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine.
| Compound Name | N-[(1R,2S)-2-(methoxymethyl)cyclopentyl]-2,7-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 50955778 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | N-[(1R,2S)-2-(methoxymethyl)cyclopentyl]-2,7-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
| SMILES | COC[C@H]1CCC[C@H]1Nc1nc(C)nc2c1CCN(C)CC2 |
| InChI | InChI=1S/C17H28N4O/c1-12-18-16-8-10-21(2)9-7-14(16)17(19-12)20-15-6-4-5-13(15)11-22-3/h13,15H,4-11H2,1-3H3,(H,18,19,20)/t13-,15-/m1/s1 |
| InChIKey | HTALUIRKOSOQNJ-UKRRQHHQSA-N |
| XLogP | 2.04 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |