C21H21F3N4O3S2 — CID 5095686
ethyl 4,5-dimethyl-2-[[5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 5095686) has the molecular formula C21H21F3N4O3S2 and a molecular weight of 498.55 g/mol. Its IUPAC name is ethyl 4,5-dimethyl-2-[[5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4,5-dimethyl-2-[[5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 5095686 |
| Molecular Formula | C21H21F3N4O3S2 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | ethyl 4,5-dimethyl-2-[[5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cc3n(n2)C(C(F)(F)F)CC(c2cccs2)N3)sc(C)c1C |
| InChI | InChI=1S/C21H21F3N4O3S2/c1-4-31-20(30)17-10(2)11(3)33-19(17)26-18(29)13-9-16-25-12(14-6-5-7-32-14)8-15(21(22,23)24)28(16)27-13/h5-7,9,12,15,25H,4,8H2,1-3H3,(H,26,29) |
| InChIKey | OGEASZXVZWLMSL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |