C19H22N6 — CID 50957258
3-methyl-7-(2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile (PubChem CID 50957258) has the molecular formula C19H22N6 and a molecular weight of 334.43 g/mol. Its IUPAC name is 3-methyl-7-(2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile.
| Compound Name | 3-methyl-7-(2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile |
|---|---|
| PubChem CID | 50957258 |
| Molecular Formula | C19H22N6 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 3-methyl-7-(2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile |
| SMILES | Cc1nc2c(c(N3CCc4c(cnc(C)c4C#N)C3)n1)CCNCC2 |
| InChI | InChI=1S/C19H22N6/c1-12-17(9-20)15-5-8-25(11-14(15)10-22-12)19-16-3-6-21-7-4-18(16)23-13(2)24-19/h10,21H,3-8,11H2,1-2H3 |
| InChIKey | MRMSPFBZCBGTDU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |