C17H25ClN4O2 — CID 50957400
3-chloro-6-[4-(1-ethylpiperidin-4-yl)piperazin-1-yl]pyridine-2-carboxylic acid (PubChem CID 50957400) has the molecular formula C17H25ClN4O2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 3-chloro-6-[4-(1-ethylpiperidin-4-yl)piperazin-1-yl]pyridine-2-carboxylic acid.
| Compound Name | 3-chloro-6-[4-(1-ethylpiperidin-4-yl)piperazin-1-yl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 50957400 |
| Molecular Formula | C17H25ClN4O2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 3-chloro-6-[4-(1-ethylpiperidin-4-yl)piperazin-1-yl]pyridine-2-carboxylic acid |
| SMILES | CCN1CCC(N2CCN(c3ccc(Cl)c(C(=O)O)n3)CC2)CC1 |
| InChI | InChI=1S/C17H25ClN4O2/c1-2-20-7-5-13(6-8-20)21-9-11-22(12-10-21)15-4-3-14(18)16(19-15)17(23)24/h3-4,13H,2,5-12H2,1H3,(H,23,24) |
| InChIKey | PPOBDYZXVMORCK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |