C11H14N4 — CID 50957417
3-methyl-2-[2-(1,2,4-triazol-4-yl)propyl]pyridine (PubChem CID 50957417) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-methyl-2-[2-(1,2,4-triazol-4-yl)propyl]pyridine.
| Compound Name | 3-methyl-2-[2-(1,2,4-triazol-4-yl)propyl]pyridine |
|---|---|
| PubChem CID | 50957417 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 3-methyl-2-[2-(1,2,4-triazol-4-yl)propyl]pyridine |
| SMILES | Cc1cccnc1CC(C)n1cnnc1 |
| InChI | InChI=1S/C11H14N4/c1-9-4-3-5-12-11(9)6-10(2)15-7-13-14-8-15/h3-5,7-8,10H,6H2,1-2H3 |
| InChIKey | ODJHVKXFTWYNLU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |