C17H34N4 — CID 50957566
8-methyl-2-[(1-propan-2-ylpiperidin-4-yl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine (PubChem CID 50957566) has the molecular formula C17H34N4 and a molecular weight of 294.49 g/mol. Its IUPAC name is 8-methyl-2-[(1-propan-2-ylpiperidin-4-yl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine.
| Compound Name | 8-methyl-2-[(1-propan-2-ylpiperidin-4-yl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine |
|---|---|
| PubChem CID | 50957566 |
| Molecular Formula | C17H34N4 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.28 |
| IUPAC Name | 8-methyl-2-[(1-propan-2-ylpiperidin-4-yl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine |
| SMILES | CC(C)N1CCC(CN2CCN3CCN(C)CC3C2)CC1 |
| InChI | InChI=1S/C17H34N4/c1-15(2)20-6-4-16(5-7-20)12-19-9-11-21-10-8-18(3)13-17(21)14-19/h15-17H,4-14H2,1-3H3 |
| InChIKey | ZUWMMWASXDKCJA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |