C17H24N2O2 — CID 50957953
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-methyl-6-oxopyridine-3-carboxamide (PubChem CID 50957953) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-methyl-6-oxopyridine-3-carboxamide.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-methyl-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 50957953 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-methyl-6-oxopyridine-3-carboxamide |
| SMILES | CC(C)=CCC/C(C)=C/CNC(=O)c1ccc(=O)n(C)c1 |
| InChI | InChI=1S/C17H24N2O2/c1-13(2)6-5-7-14(3)10-11-18-17(21)15-8-9-16(20)19(4)12-15/h6,8-10,12H,5,7,11H2,1-4H3,(H,18,21)/b14-10+ |
| InChIKey | YQDPVOGUJUJIHQ-GXDHUFHOSA-N |
| XLogP | 2.81 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|