C22H27NO2S — CID 50958021
(3S,4R)-1-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]-4-(3-methylthiophen-2-yl)piperidin-3-ol (PubChem CID 50958021) has the molecular formula C22H27NO2S and a molecular weight of 369.53 g/mol. Its IUPAC name is (3S,4R)-1-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]-4-(3-methylthiophen-2-yl)piperidin-3-ol.
| Compound Name | (3S,4R)-1-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]-4-(3-methylthiophen-2-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 50958021 |
| Molecular Formula | C22H27NO2S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (3S,4R)-1-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]-4-(3-methylthiophen-2-yl)piperidin-3-ol |
| SMILES | Cc1ccsc1[C@@H]1CCN(Cc2ccc(C#CC(C)(C)O)cc2)C[C@H]1O |
| InChI | InChI=1S/C22H27NO2S/c1-16-10-13-26-21(16)19-9-12-23(15-20(19)24)14-18-6-4-17(5-7-18)8-11-22(2,3)25/h4-7,10,13,19-20,24-25H,9,12,14-15H2,1-3H3/t19-,20-/m1/s1 |
| InChIKey | IJYJHGJVEQBBMZ-WOJBJXKFSA-N |
| XLogP | 3.53 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|