C17H21N3O3 — CID 50958234
2-(3,4-dimethoxyphenyl)-7,7-dimethyl-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one (PubChem CID 50958234) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-7,7-dimethyl-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-7,7-dimethyl-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one |
|---|---|
| PubChem CID | 50958234 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-7,7-dimethyl-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one |
| SMILES | COc1ccc(-c2nc3c([nH]2)CC(C)(C)CNC3=O)cc1OC |
| InChI | InChI=1S/C17H21N3O3/c1-17(2)8-11-14(16(21)18-9-17)20-15(19-11)10-5-6-12(22-3)13(7-10)23-4/h5-7H,8-9H2,1-4H3,(H,18,21)(H,19,20) |
| InChIKey | FDFSZFXWOQOEMF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |