C15H22N4O4 — CID 50958455
N-cyclohexyl-2-(6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)-2-oxoacetamide (PubChem CID 50958455) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is N-cyclohexyl-2-(6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)-2-oxoacetamide.
| Compound Name | N-cyclohexyl-2-(6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 50958455 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | N-cyclohexyl-2-(6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)-2-oxoacetamide |
| SMILES | O=C(NC1CCCCC1)C(=O)N1CCN2C(=O)CNC(=O)C2C1 |
| InChI | InChI=1S/C15H22N4O4/c20-12-8-16-13(21)11-9-18(6-7-19(11)12)15(23)14(22)17-10-4-2-1-3-5-10/h10-11H,1-9H2,(H,16,21)(H,17,22) |
| InChIKey | KAXNKRYRHXFTAR-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|