C14H21N3O3 — CID 50958544
1-[(3aR,6aR)-3a-(2,5-dihydropyrrole-1-carbonyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methoxyethanone (PubChem CID 50958544) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 1-[(3aR,6aR)-3a-(2,5-dihydropyrrole-1-carbonyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methoxyethanone.
| Compound Name | 1-[(3aR,6aR)-3a-(2,5-dihydropyrrole-1-carbonyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 50958544 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 1-[(3aR,6aR)-3a-(2,5-dihydropyrrole-1-carbonyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1C[C@H]2CNC[C@@]2(C(=O)N2CC=CC2)C1 |
| InChI | InChI=1S/C14H21N3O3/c1-20-8-12(18)17-7-11-6-15-9-14(11,10-17)13(19)16-4-2-3-5-16/h2-3,11,15H,4-10H2,1H3/t11-,14-/m1/s1 |
| InChIKey | RYNACVIZHBJYDW-BXUZGUMPSA-N |
| XLogP | -0.92 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|