About 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine
2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine (PubChem CID 5095891) has the molecular formula C5H7ClN4S
and a molecular weight of 190.66 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine.
Molecular Properties
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine |
| PubChem CID | 5095891 |
| Molecular Formula | C5H7ClN4S |
| Molecular Weight | 190.66 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nc(CCl)cs1 |
| InChI | InChI=1S/C5H7ClN4S/c6-1-3-2-11-5(9-3)10-4(7)8/h2H,1H2,(H4,7,8,9,10) |
| InChIKey | LUUXKXPRQLQHQR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.66 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine?
The IUPAC name of 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine (CID 5095891) is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine.
What is the SMILES notation for 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine?
The canonical SMILES for 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine is NC(N)=Nc1nc(CCl)cs1.
What is the InChIKey of 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine?
The InChIKey is LUUXKXPRQLQHQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN4S/c6-1-3-2-11-5(9-3)10-4(7)8/h2H,1H2,(H4,7,8,9,10).
What are the key properties of 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine?
2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine has a molecular weight of 190.66 g/mol, XLogP of 0.79, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine is sourced from PubChem (CID 5095891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).