C10H12F3N3O3 — CID 50958937
N-[(7R,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3,3,3-trifluoropropanamide (PubChem CID 50958937) has the molecular formula C10H12F3N3O3 and a molecular weight of 279.22 g/mol. Its IUPAC name is N-[(7R,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[(7R,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 50958937 |
| Molecular Formula | C10H12F3N3O3 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | N-[(7R,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3,3,3-trifluoropropanamide |
| SMILES | O=C(CC(F)(F)F)N[C@@H]1C[C@H]2C(=O)NCC(=O)N2C1 |
| InChI | InChI=1S/C10H12F3N3O3/c11-10(12,13)2-7(17)15-5-1-6-9(19)14-3-8(18)16(6)4-5/h5-6H,1-4H2,(H,14,19)(H,15,17)/t5-,6+/m1/s1 |
| InChIKey | LEUWIEDAISSQRG-RITPCOANSA-N |
| XLogP | -0.85 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |