C14H23N3O3 — CID 50959711
2-[1-(methoxymethyl)cyclopropanecarbonyl]-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one (PubChem CID 50959711) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-[1-(methoxymethyl)cyclopropanecarbonyl]-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one.
| Compound Name | 2-[1-(methoxymethyl)cyclopropanecarbonyl]-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
|---|---|
| PubChem CID | 50959711 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 2-[1-(methoxymethyl)cyclopropanecarbonyl]-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
| SMILES | COCC1(C(=O)N2CCN3CCN(C)C(=O)C3C2)CC1 |
| InChI | InChI=1S/C14H23N3O3/c1-15-5-6-16-7-8-17(9-11(16)12(15)18)13(19)14(3-4-14)10-20-2/h11H,3-10H2,1-2H3 |
| InChIKey | XQJYYTJWWCJPCG-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |