C19H28N4O — CID 50959792
3-methyl-N-[[3-(2-methylprop-2-enoxy)phenyl]methyl]-1-(2-methyl-1,2,4-triazol-3-yl)butan-1-amine (PubChem CID 50959792) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is 3-methyl-N-[[3-(2-methylprop-2-enoxy)phenyl]methyl]-1-(2-methyl-1,2,4-triazol-3-yl)butan-1-amine.
| Compound Name | 3-methyl-N-[[3-(2-methylprop-2-enoxy)phenyl]methyl]-1-(2-methyl-1,2,4-triazol-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 50959792 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 3-methyl-N-[[3-(2-methylprop-2-enoxy)phenyl]methyl]-1-(2-methyl-1,2,4-triazol-3-yl)butan-1-amine |
| SMILES | C=C(C)COc1cccc(CNC(CC(C)C)c2ncnn2C)c1 |
| InChI | InChI=1S/C19H28N4O/c1-14(2)9-18(19-21-13-22-23(19)5)20-11-16-7-6-8-17(10-16)24-12-15(3)4/h6-8,10,13-14,18,20H,3,9,11-12H2,1-2,4-5H3 |
| InChIKey | SUKOUALYIKZTLT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|