About 4-(benzylamino)-N-[(3R,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-yl]butanamide
4-(benzylamino)-N-[(3R,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-yl]butanamide (PubChem CID 50959805) has the molecular formula C17H27N3O2
and a molecular weight of 305.42 g/mol. Its IUPAC name is 4-(benzylamino)-N-[(3R,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-yl]butanamide.
Molecular Properties
| Compound Name | 4-(benzylamino)-N-[(3R,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-yl]butanamide |
| PubChem CID | 50959805 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 4-(benzylamino)-N-[(3R,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-yl]butanamide |
| SMILES | CN1C[C@H](NC(=O)CCCNCc2ccccc2)C[C@H]1CO |
| InChI | InChI=1S/C17H27N3O2/c1-20-12-15(10-16(20)13-21)19-17(22)8-5-9-18-11-14-6-3-2-4-7-14/h2-4,6-7,15-16,18,21H,5,8-13H2,1H3,(H,19,22)/t15-,16+/m1/s1 |
| InChIKey | SOUFADCUXCMFEE-CVEARBPZSA-N |
| XLogP | 0.74 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(benzylamino)-N-[(3R,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzylamino)-N-[(3R,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-yl]butanamide?
The IUPAC name of 4-(benzylamino)-N-[(3R,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-yl]butanamide (CID 50959805) is 4-(benzylamino)-N-[(3R,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-yl]butanamide.
What is the SMILES notation for 4-(benzylamino)-N-[(3R,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-yl]butanamide?
The canonical SMILES for 4-(benzylamino)-N-[(3R,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-yl]butanamide is CN1C[C@H](NC(=O)CCCNCc2ccccc2)C[C@H]1CO.
What is the InChIKey of 4-(benzylamino)-N-[(3R,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-yl]butanamide?
The InChIKey is SOUFADCUXCMFEE-CVEARBPZSA-N. The full InChI is InChI=1S/C17H27N3O2/c1-20-12-15(10-16(20)13-21)19-17(22)8-5-9-18-11-14-6-3-2-4-7-14/h2-4,6-7,15-16,18,21H,5,8-13H2,1H3,(H,19,22)/t15-,16+/m1/s1.
What are the key properties of 4-(benzylamino)-N-[(3R,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-yl]butanamide?
4-(benzylamino)-N-[(3R,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-yl]butanamide has a molecular weight of 305.42 g/mol, XLogP of 0.74, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzylamino)-N-[(3R,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-yl]butanamide is sourced from PubChem (CID 50959805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).