About 2-(4,4-difluoropiperidin-1-yl)-N-ethylpyrimidin-4-amine
2-(4,4-difluoropiperidin-1-yl)-N-ethylpyrimidin-4-amine (PubChem CID 50959945) has the molecular formula C11H16F2N4
and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)-N-ethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)-N-ethylpyrimidin-4-amine |
| PubChem CID | 50959945 |
| Molecular Formula | C11H16F2N4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)-N-ethylpyrimidin-4-amine |
| SMILES | CCNc1ccnc(N2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C11H16F2N4/c1-2-14-9-3-6-15-10(16-9)17-7-4-11(12,13)5-8-17/h3,6H,2,4-5,7-8H2,1H3,(H,14,15,16) |
| InChIKey | VZYCSUDALSLWJX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,4-difluoropiperidin-1-yl)-N-ethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluoropiperidin-1-yl)-N-ethylpyrimidin-4-amine?
The IUPAC name of 2-(4,4-difluoropiperidin-1-yl)-N-ethylpyrimidin-4-amine (CID 50959945) is 2-(4,4-difluoropiperidin-1-yl)-N-ethylpyrimidin-4-amine.
What is the SMILES notation for 2-(4,4-difluoropiperidin-1-yl)-N-ethylpyrimidin-4-amine?
The canonical SMILES for 2-(4,4-difluoropiperidin-1-yl)-N-ethylpyrimidin-4-amine is CCNc1ccnc(N2CCC(F)(F)CC2)n1.
What is the InChIKey of 2-(4,4-difluoropiperidin-1-yl)-N-ethylpyrimidin-4-amine?
The InChIKey is VZYCSUDALSLWJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F2N4/c1-2-14-9-3-6-15-10(16-9)17-7-4-11(12,13)5-8-17/h3,6H,2,4-5,7-8H2,1H3,(H,14,15,16).
What are the key properties of 2-(4,4-difluoropiperidin-1-yl)-N-ethylpyrimidin-4-amine?
2-(4,4-difluoropiperidin-1-yl)-N-ethylpyrimidin-4-amine has a molecular weight of 242.27 g/mol, XLogP of 2.14, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluoropiperidin-1-yl)-N-ethylpyrimidin-4-amine is sourced from PubChem (CID 50959945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).