C21H25FN2O — CID 50960830
[(1R,3S,3aS,6aR)-5-benzyl-3-(2-fluoro-4-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-1-yl]methanol (PubChem CID 50960830) has the molecular formula C21H25FN2O and a molecular weight of 340.44 g/mol. Its IUPAC name is [(1R,3S,3aS,6aR)-5-benzyl-3-(2-fluoro-4-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-1-yl]methanol.
| Compound Name | [(1R,3S,3aS,6aR)-5-benzyl-3-(2-fluoro-4-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-1-yl]methanol |
|---|---|
| PubChem CID | 50960830 |
| Molecular Formula | C21H25FN2O |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | [(1R,3S,3aS,6aR)-5-benzyl-3-(2-fluoro-4-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-1-yl]methanol |
| SMILES | Cc1ccc([C@H]2N[C@@H](CO)[C@H]3CN(Cc4ccccc4)C[C@H]32)c(F)c1 |
| InChI | InChI=1S/C21H25FN2O/c1-14-7-8-16(19(22)9-14)21-18-12-24(10-15-5-3-2-4-6-15)11-17(18)20(13-25)23-21/h2-9,17-18,20-21,23,25H,10-13H2,1H3/t17-,18+,20-,21+/m0/s1 |
| InChIKey | WFJRGIOZHHQZSG-IZZBFERCSA-N |
| XLogP | 2.89 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |